C16H27IO3 — CID 129031595
(3R,5R)-1-[(2S,5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol (PubChem CID 129031595) has the molecular formula C16H27IO3 and a molecular weight of 394.29 g/mol. Its IUPAC name is (3R,5R)-1-[(2S,5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol.
| Compound Name | (3R,5R)-1-[(2S,5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol |
|---|---|
| PubChem CID | 129031595 |
| Molecular Formula | C16H27IO3 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (3R,5R)-1-[(2S,5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol |
| SMILES | C=C(I)[C@H](C)C[C@H](O)CC[C@@H]1O[C@@H](CCCO)CC1=C |
| InChI | InChI=1S/C16H27IO3/c1-11(13(3)17)9-14(19)6-7-16-12(2)10-15(20-16)5-4-8-18/h11,14-16,18-19H,2-10H2,1H3/t11-,14-,15+,16+/m1/s1 |
| InChIKey | DKJMCYPXFCHYCK-FWYOQMDTSA-N |
| XLogP | 3.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|