C32H45IO3Si — CID 11490586
(3R,5R)-1-[(2S,5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol (PubChem CID 11490586) has the molecular formula C32H45IO3Si and a molecular weight of 632.70 g/mol. Its IUPAC name is (3R,5R)-1-[(2S,5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol.
| Compound Name | (3R,5R)-1-[(2S,5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol |
|---|---|
| PubChem CID | 11490586 |
| Molecular Formula | C32H45IO3Si |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | (3R,5R)-1-[(2S,5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-6-iodo-5-methylhept-6-en-3-ol |
| SMILES | C=C(I)[C@H](C)C[C@H](O)CC[C@@H]1O[C@@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1=C |
| InChI | InChI=1S/C32H45IO3Si/c1-24(26(3)33)22-27(34)19-20-31-25(2)23-28(36-31)14-13-21-35-37(32(4,5)6,29-15-9-7-10-16-29)30-17-11-8-12-18-30/h7-12,15-18,24,27-28,31,34H,2-3,13-14,19-23H2,1,4-6H3/t24-,27-,28+,31+/m1/s1 |
| InChIKey | PTQLJJYCAVATSK-UOKCPPMWSA-N |
| XLogP | 7.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|