C25H36O3 — CID 90211081
3-[(2S)-4-methylidene-5-[(5R)-3,5,6-trimethylhept-6-enyl]oxolan-2-yl]propyl benzoate (PubChem CID 90211081) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 3-[(2S)-4-methylidene-5-[(5R)-3,5,6-trimethylhept-6-enyl]oxolan-2-yl]propyl benzoate.
| Compound Name | 3-[(2S)-4-methylidene-5-[(5R)-3,5,6-trimethylhept-6-enyl]oxolan-2-yl]propyl benzoate |
|---|---|
| PubChem CID | 90211081 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 3-[(2S)-4-methylidene-5-[(5R)-3,5,6-trimethylhept-6-enyl]oxolan-2-yl]propyl benzoate |
| SMILES | C=C1C[C@H](CCCOC(=O)c2ccccc2)OC1CCC(C)C[C@@H](C)C(=C)C |
| InChI | InChI=1S/C25H36O3/c1-18(2)20(4)16-19(3)13-14-24-21(5)17-23(28-24)12-9-15-27-25(26)22-10-7-6-8-11-22/h6-8,10-11,19-20,23-24H,1,5,9,12-17H2,2-4H3/t19?,20-,23+,24?/m1/s1 |
| InChIKey | XNSNARANQSZYOI-LNOAIATOSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|