C18H32O2 — CID 58077700
(3R,5R)-1-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-5,6-dimethylhept-6-en-3-ol (PubChem CID 58077700) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (3R,5R)-1-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-5,6-dimethylhept-6-en-3-ol.
| Compound Name | (3R,5R)-1-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-5,6-dimethylhept-6-en-3-ol |
|---|---|
| PubChem CID | 58077700 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (3R,5R)-1-[(2S,5S)-5-butyl-3-methylideneoxolan-2-yl]-5,6-dimethylhept-6-en-3-ol |
| SMILES | C=C(C)[C@H](C)C[C@H](O)CC[C@@H]1O[C@@H](CCCC)CC1=C |
| InChI | InChI=1S/C18H32O2/c1-6-7-8-17-12-15(5)18(20-17)10-9-16(19)11-14(4)13(2)3/h14,16-19H,2,5-12H2,1,3-4H3/t14-,16-,17+,18+/m1/s1 |
| InChIKey | TUKZQKRAULWHNH-BGTYHANMSA-N |
| XLogP | 4.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|