C37H67NO5 — CID 159288385
(3R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one;(2R)-6-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide (PubChem CID 159288385) has the molecular formula C37H67NO5 and a molecular weight of 605.95 g/mol. Its IUPAC name is (3R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one;(2R)-6-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide.
| Compound Name | (3R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one;(2R)-6-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide |
|---|---|
| PubChem CID | 159288385 |
| Molecular Formula | C37H67NO5 |
| Molecular Weight | 605.95 g/mol |
| Exact Mass | 605.50 |
| IUPAC Name | (3R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one;(2R)-6-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide |
| SMILES | C=C1C[C@H](CCCC)OC1CCC(C)C[C@@H](C)C(=O)N(C)OC.C=C1C[C@H](CCCC)OC1CCC(C)C[C@@H](C)C(C)=O |
| InChI | InChI=1S/C19H35NO3.C18H32O2/c1-7-8-9-17-13-15(3)18(23-17)11-10-14(2)12-16(4)19(21)20(5)22-6;1-6-7-8-17-12-15(4)18(20-17)10-9-13(2)11-14(3)16(5)19/h14,16-18H,3,7-13H2,1-2,4-6H3;13-14,17-18H,4,6-12H2,1-3,5H3/t14?,16-,17+,18?;13?,14-,17+,18?/m11/s1 |
| InChIKey | KZUKPGUPFNNMHZ-SUKZABSNSA-N |
| XLogP | 9.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.95 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|