C24H43F3O5SSi — CID 58991074
[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-5-butyl-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 58991074) has the molecular formula C24H43F3O5SSi and a molecular weight of 528.75 g/mol. Its IUPAC name is [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-5-butyl-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-5-butyl-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58991074 |
| Molecular Formula | C24H43F3O5SSi |
| Molecular Weight | 528.75 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-5-butyl-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)[C@H](C)C[C@@H](CC[C@@H]1OC(CCCC)CC1=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43F3O5SSi/c1-10-11-12-20-16-18(3)22(30-20)14-13-21(32-34(8,9)23(5,6)7)15-17(2)19(4)31-33(28,29)24(25,26)27/h17,20-22H,3-4,10-16H2,1-2,5-9H3/t17-,20?,21-,22+/m1/s1 |
| InChIKey | WNUKZZVRSJHJFV-AMZGXZFVSA-N |
| XLogP | 7.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.75 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|