C18H31IO — CID 18716228
5-butyl-2-(6-iodo-3,5-dimethylhept-6-enyl)-3-methylideneoxolane (PubChem CID 18716228) has the molecular formula C18H31IO and a molecular weight of 390.35 g/mol. Its IUPAC name is 5-butyl-2-(6-iodo-3,5-dimethylhept-6-enyl)-3-methylideneoxolane.
| Compound Name | 5-butyl-2-(6-iodo-3,5-dimethylhept-6-enyl)-3-methylideneoxolane |
|---|---|
| PubChem CID | 18716228 |
| Molecular Formula | C18H31IO |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-butyl-2-(6-iodo-3,5-dimethylhept-6-enyl)-3-methylideneoxolane |
| SMILES | C=C(I)C(C)CC(C)CCC1OC(CCCC)CC1=C |
| InChI | InChI=1S/C18H31IO/c1-6-7-8-17-12-15(4)18(20-17)10-9-13(2)11-14(3)16(5)19/h13-14,17-18H,4-12H2,1-3H3 |
| InChIKey | NRMZEVMJEIYVPA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|