C34H51NO4Si — CID 58077855
(4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide (PubChem CID 58077855) has the molecular formula C34H51NO4Si and a molecular weight of 565.87 g/mol. Its IUPAC name is (4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide.
| Compound Name | (4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide |
|---|---|
| PubChem CID | 58077855 |
| Molecular Formula | C34H51NO4Si |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | (4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide |
| SMILES | C=C1C[C@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1CC[C@@H](C)CC(C)C(=O)N(C)OC |
| InChI | InChI=1S/C34H51NO4Si/c1-26(24-28(3)33(36)35(7)37-8)21-22-32-27(2)25-29(39-32)16-15-23-38-40(34(4,5)6,30-17-11-9-12-18-30)31-19-13-10-14-20-31/h9-14,17-20,26,28-29,32H,2,15-16,21-25H2,1,3-8H3/t26-,28?,29+,32?/m1/s1 |
| InChIKey | IRQPJLDBALDIEX-XVWKNIOPSA-N |
| XLogP | 6.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|