C34H51NO4Si — CID 11039048
[(2R,3R,6S)-4-methylidene-2,6-dipropyloxan-3-yl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate (PubChem CID 11039048) has the molecular formula C34H51NO4Si and a molecular weight of 565.87 g/mol. Its IUPAC name is [(2R,3R,6S)-4-methylidene-2,6-dipropyloxan-3-yl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate.
| Compound Name | [(2R,3R,6S)-4-methylidene-2,6-dipropyloxan-3-yl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 11039048 |
| Molecular Formula | C34H51NO4Si |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | [(2R,3R,6S)-4-methylidene-2,6-dipropyloxan-3-yl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate |
| SMILES | C=C1C[C@H](CCC)O[C@H](CCC)[C@@H]1OC(=O)N(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C34H51NO4Si/c1-9-17-28-25-27(5)32(31(38-28)18-10-2)39-33(36)35(26(3)4)23-24-37-40(34(6,7)8,29-19-13-11-14-20-29)30-21-15-12-16-22-30/h11-16,19-22,26,28,31-32H,5,9-10,17-18,23-25H2,1-4,6-8H3/t28-,31+,32+/m0/s1 |
| InChIKey | HIHZLVYASZTOBE-AVXDPSIRSA-N |
| XLogP | 7.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|