C32H40O3Si — CID 101170902
tert-butyl-[2-[(6R)-4-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]ethoxy]-diphenylsilane (PubChem CID 101170902) has the molecular formula C32H40O3Si and a molecular weight of 500.76 g/mol. Its IUPAC name is tert-butyl-[2-[(6R)-4-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(6R)-4-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101170902 |
| Molecular Formula | C32H40O3Si |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | tert-butyl-[2-[(6R)-4-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]ethoxy]-diphenylsilane |
| SMILES | C=C1CC(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C32H40O3Si/c1-26-22-28(35-29(23-26)25-33-24-27-14-8-5-9-15-27)20-21-34-36(32(2,3)4,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-19,28-29H,1,20-25H2,2-4H3/t28?,29-/m1/s1 |
| InChIKey | ASELTOOWNDLUCJ-YPJJGMIRSA-N |
| XLogP | 6.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|