C23H28O4Si — CID 102044469
(1S,3R,5R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,6-dioxabicyclo[3.2.0]heptan-7-one (PubChem CID 102044469) has the molecular formula C23H28O4Si and a molecular weight of 396.56 g/mol. Its IUPAC name is (1S,3R,5R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,6-dioxabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1S,3R,5R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,6-dioxabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 102044469 |
| Molecular Formula | C23H28O4Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1S,3R,5R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,6-dioxabicyclo[3.2.0]heptan-7-one |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1C[C@H]2OC(=O)[C@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O4Si/c1-23(2,3)28(18-10-6-4-7-11-18,19-12-8-5-9-13-19)25-15-14-17-16-20-21(26-17)22(24)27-20/h4-13,17,20-21H,14-16H2,1-3H3/t17-,20-,21+/m1/s1 |
| InChIKey | GGYWADSOYCRRDS-UIFIKXQLSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|