C24H31IO4Si — CID 11027918
(4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(iodomethyl)-4-methyl-1,3-dioxan-2-one (PubChem CID 11027918) has the molecular formula C24H31IO4Si and a molecular weight of 538.50 g/mol. Its IUPAC name is (4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(iodomethyl)-4-methyl-1,3-dioxan-2-one.
| Compound Name | (4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(iodomethyl)-4-methyl-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 11027918 |
| Molecular Formula | C24H31IO4Si |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | (4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(iodomethyl)-4-methyl-1,3-dioxan-2-one |
| SMILES | CC(C)(C)[Si](OCC[C@H]1C[C@@](C)(CI)OC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31IO4Si/c1-23(2,3)30(20-11-7-5-8-12-20,21-13-9-6-10-14-21)27-16-15-19-17-24(4,18-25)29-22(26)28-19/h5-14,19H,15-18H2,1-4H3/t19-,24-/m0/s1 |
| InChIKey | NUFUIJJFQOMDMB-CYFREDJKSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|