C30H36O4SSi — CID 25032960
(3S,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one (PubChem CID 25032960) has the molecular formula C30H36O4SSi and a molecular weight of 520.77 g/mol. Its IUPAC name is (3S,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3S,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 25032960 |
| Molecular Formula | C30H36O4SSi |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | (3S,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(2-hydroxyethyl)-3-phenylsulfanyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36O4SSi/c1-30(2,3)36(24-15-9-5-10-16-24,25-17-11-6-12-18-25)33-22-20-27-26(19-21-31)28(29(32)34-27)35-23-13-7-4-8-14-23/h4-18,26-28,31H,19-22H2,1-3H3/t26-,27+,28+/m1/s1 |
| InChIKey | FGFRRSWQGLZUOT-PKTNWEFCSA-N |
| XLogP | 5.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|