C32H38O3SSi — CID 44580071
(3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one (PubChem CID 44580071) has the molecular formula C32H38O3SSi and a molecular weight of 530.81 g/mol. Its IUPAC name is (3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 44580071 |
| Molecular Formula | C32H38O3SSi |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (3S,4R,5R)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
| SMILES | C=CC[C@H]1[C@H](Sc2ccccc2)C(=O)O[C@@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H38O3SSi/c1-5-16-28-29(35-31(33)30(28)36-25-17-9-6-10-18-25)23-15-24-34-37(32(2,3)4,26-19-11-7-12-20-26)27-21-13-8-14-22-27/h5-14,17-22,28-30H,1,15-16,23-24H2,2-4H3/t28-,29-,30+/m1/s1 |
| InChIKey | ZGCTVUUBMCBOIR-OCBJUFRSSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|