C30H35NO3Si — CID 15038414
(4S,5S)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 15038414) has the molecular formula C30H35NO3Si and a molecular weight of 485.70 g/mol. Its IUPAC name is (4S,5S)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15038414 |
| Molecular Formula | C30H35NO3Si |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | (4S,5S)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H35NO3Si/c1-5-15-27-28(34-29(32)31(27)22-24-16-9-6-10-17-24)23-33-35(30(2,3)4,25-18-11-7-12-19-25)26-20-13-8-14-21-26/h5-14,16-21,27-28H,1,15,22-23H2,2-4H3/t27-,28+/m0/s1 |
| InChIKey | ZXCWEIKOSQYUKM-WUFINQPMSA-N |
| XLogP | 5.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|