C24H40N2O2Si — CID 11538939
(3R,5R,6S)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-propan-2-yl-3-prop-2-enylpiperazin-2-one (PubChem CID 11538939) has the molecular formula C24H40N2O2Si and a molecular weight of 416.68 g/mol. Its IUPAC name is (3R,5R,6S)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-propan-2-yl-3-prop-2-enylpiperazin-2-one.
| Compound Name | (3R,5R,6S)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-propan-2-yl-3-prop-2-enylpiperazin-2-one |
|---|---|
| PubChem CID | 11538939 |
| Molecular Formula | C24H40N2O2Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (3R,5R,6S)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-propan-2-yl-3-prop-2-enylpiperazin-2-one |
| SMILES | C=CC[C@H]1N[C@H](C(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H40N2O2Si/c1-9-13-20-23(27)26(16-19-14-11-10-12-15-19)21(22(25-20)18(2)3)17-28-29(7,8)24(4,5)6/h9-12,14-15,18,20-22,25H,1,13,16-17H2,2-8H3/t20-,21-,22-/m1/s1 |
| InChIKey | OPADBYHUVMVMGH-YPAWHYETSA-N |
| XLogP | 4.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|