C18H31NOSi — CID 12030475
[(2R,3S)-1-benzyl-3-ethylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 12030475) has the molecular formula C18H31NOSi and a molecular weight of 305.54 g/mol. Its IUPAC name is [(2R,3S)-1-benzyl-3-ethylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S)-1-benzyl-3-ethylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 12030475 |
| Molecular Formula | C18H31NOSi |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | [(2R,3S)-1-benzyl-3-ethylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H31NOSi/c1-7-16-17(14-20-21(5,6)18(2,3)4)19(16)13-15-11-9-8-10-12-15/h8-12,16-17H,7,13-14H2,1-6H3/t16-,17-,19?/m0/s1 |
| InChIKey | BBBQIRJPXFPDDD-YGYNJSFOSA-N |
| XLogP | 4.67 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|