C20H31NOSi — CID 10980405
(1-benzyl-3,4-dimethylidenepyrrolidin-2-yl)methoxy-tert-butyl-dimethylsilane (PubChem CID 10980405) has the molecular formula C20H31NOSi and a molecular weight of 329.56 g/mol. Its IUPAC name is (1-benzyl-3,4-dimethylidenepyrrolidin-2-yl)methoxy-tert-butyl-dimethylsilane.
| Compound Name | (1-benzyl-3,4-dimethylidenepyrrolidin-2-yl)methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10980405 |
| Molecular Formula | C20H31NOSi |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (1-benzyl-3,4-dimethylidenepyrrolidin-2-yl)methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CN(Cc2ccccc2)C(CO[Si](C)(C)C(C)(C)C)C1=C |
| InChI | InChI=1S/C20H31NOSi/c1-16-13-21(14-18-11-9-8-10-12-18)19(17(16)2)15-22-23(6,7)20(3,4)5/h8-12,19H,1-2,13-15H2,3-7H3 |
| InChIKey | KPONEYDYGFOUMI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|