C20H33NO3Si — CID 15415065
[(3aS,4S,7aS)-1-benzyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazol-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 15415065) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is [(3aS,4S,7aS)-1-benzyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazol-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,7aS)-1-benzyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazol-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15415065 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | [(3aS,4S,7aS)-1-benzyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazol-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1COC[C@@H]2[C@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C20H33NO3Si/c1-20(2,3)25(4,5)24-13-17-12-22-15-19-18(17)14-23-21(19)11-16-9-7-6-8-10-16/h6-10,17-19H,11-15H2,1-5H3/t17-,18-,19+/m0/s1 |
| InChIKey | FNPQCRYSRNGCEQ-GBESFXJTSA-N |
| XLogP | 4.09 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|