C25H34F3NOSi — CID 68909864
[(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 68909864) has the molecular formula C25H34F3NOSi and a molecular weight of 449.63 g/mol. Its IUPAC name is [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 68909864 |
| Molecular Formula | C25H34F3NOSi |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H34F3NOSi/c1-24(2,3)31(4,5)30-18-21-16-29(15-19-10-7-6-8-11-19)17-23(21)20-12-9-13-22(14-20)25(26,27)28/h6-14,21,23H,15-18H2,1-5H3/t21-,23-/m1/s1 |
| InChIKey | SURYTKUJYUSSKK-FYYLOGMGSA-N |
| XLogP | 6.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|