C18H19F3N2 — CID 139593254
(3S,4R)-1-benzyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-3-amine (PubChem CID 139593254) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-benzyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 139593254 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (3S,4R)-1-benzyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2/c19-18(20,21)15-8-6-14(7-9-15)16-11-23(12-17(16)22)10-13-4-2-1-3-5-13/h1-9,16-17H,10-12,22H2/t16-,17+/m0/s1 |
| InChIKey | RHVLEHJTSYWVDW-DLBZAZTESA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |