C17H17F3N2 — CID 66606644
(3R,4S)-1-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 66606644) has the molecular formula C17H17F3N2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 66606644 |
| Molecular Formula | C17H17F3N2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H17F3N2/c18-14-7-16(20)15(19)6-12(14)13-9-22(10-17(13)21)8-11-4-2-1-3-5-11/h1-7,13,17H,8-10,21H2/t13-,17+/m1/s1 |
| InChIKey | GIFBWXCLCGYFRS-DYVFJYSZSA-N |
| XLogP | 3.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|