C12H16F2N2 — CID 146050042
(3S,4R)-1-benzyl-4-(difluoromethyl)pyrrolidin-3-amine (PubChem CID 146050042) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-(difluoromethyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-benzyl-4-(difluoromethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 146050042 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (3S,4R)-1-benzyl-4-(difluoromethyl)pyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(Cc2ccccc2)C[C@H]1C(F)F |
| InChI | InChI=1S/C12H16F2N2/c13-12(14)10-7-16(8-11(10)15)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8,15H2/t10-,11-/m1/s1 |
| InChIKey | ILXCFTWJGQNMIP-GHMZBOCLSA-N |
| XLogP | 1.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |