C13H17F2NO2 — CID 126703574
(3R,4R)-1-benzyl-5-(difluoromethyl)piperidine-3,4-diol (PubChem CID 126703574) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-5-(difluoromethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R)-1-benzyl-5-(difluoromethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 126703574 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (3R,4R)-1-benzyl-5-(difluoromethyl)piperidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CC(C(F)F)[C@H]1O |
| InChI | InChI=1S/C13H17F2NO2/c14-13(15)10-7-16(8-11(17)12(10)18)6-9-4-2-1-3-5-9/h1-5,10-13,17-18H,6-8H2/t10?,11-,12-/m1/s1 |
| InChIKey | RKBNJMKGNYNQOD-PQDIPPBSSA-N |
| XLogP | 1.11 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |