C17H18Cl2N2 — CID 131117119
1-benzyl-4-(3,5-dichlorophenyl)pyrrolidin-3-amine (PubChem CID 131117119) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-benzyl-4-(3,5-dichlorophenyl)pyrrolidin-3-amine.
| Compound Name | 1-benzyl-4-(3,5-dichlorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 131117119 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-benzyl-4-(3,5-dichlorophenyl)pyrrolidin-3-amine |
| SMILES | NC1CN(Cc2ccccc2)CC1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2/c18-14-6-13(7-15(19)8-14)16-10-21(11-17(16)20)9-12-4-2-1-3-5-12/h1-8,16-17H,9-11,20H2 |
| InChIKey | UKSUTJYVEPVVNY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |