C17H21N3 — CID 146402230
(3R,4S)-1-benzyl-4-(6-methyl-3-pyridinyl)pyrrolidin-3-amine (PubChem CID 146402230) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(6-methyl-3-pyridinyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-benzyl-4-(6-methyl-3-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 146402230 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(6-methyl-3-pyridinyl)pyrrolidin-3-amine |
| SMILES | Cc1ccc([C@H]2CN(Cc3ccccc3)C[C@@H]2N)cn1 |
| InChI | InChI=1S/C17H21N3/c1-13-7-8-15(9-19-13)16-11-20(12-17(16)18)10-14-5-3-2-4-6-14/h2-9,16-17H,10-12,18H2,1H3/t16-,17+/m1/s1 |
| InChIKey | IHBXEVXRQPFUCY-SJORKVTESA-N |
| XLogP | 2.32 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |