C21H23N3 — CID 120846809
(3S,4R)-1-[(2-methylquinolin-6-yl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120846809) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is (3S,4R)-1-[(2-methylquinolin-6-yl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(2-methylquinolin-6-yl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120846809 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (3S,4R)-1-[(2-methylquinolin-6-yl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | Cc1ccc2cc(CN3C[C@@H](N)[C@H](c4ccccc4)C3)ccc2n1 |
| InChI | InChI=1S/C21H23N3/c1-15-7-9-18-11-16(8-10-21(18)23-15)12-24-13-19(20(22)14-24)17-5-3-2-4-6-17/h2-11,19-20H,12-14,22H2,1H3/t19-,20+/m0/s1 |
| InChIKey | AXRRZJVZTTVDJZ-VQTJNVASSA-N |
| XLogP | 3.47 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |