C24H26N2O — CID 129353823
(3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidin-3-amine (PubChem CID 129353823) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidin-3-amine.
| Compound Name | (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 129353823 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CN(Cc2ccccc2)C[C@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2O/c25-24-17-26(15-19-8-3-1-4-9-19)16-23(24)21-12-7-13-22(14-21)27-18-20-10-5-2-6-11-20/h1-14,23-24H,15-18,25H2/t23-,24-/m0/s1 |
| InChIKey | PMVUKWUXUVWXEP-ZEQRLZLVSA-N |
| XLogP | 4.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |