C19H21F2N — CID 123467525
(3R,4S)-1-benzyl-3-(3,4-difluorophenyl)-4-ethylpyrrolidine (PubChem CID 123467525) has the molecular formula C19H21F2N and a molecular weight of 301.38 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-3-(3,4-difluorophenyl)-4-ethylpyrrolidine.
| Compound Name | (3R,4S)-1-benzyl-3-(3,4-difluorophenyl)-4-ethylpyrrolidine |
|---|---|
| PubChem CID | 123467525 |
| Molecular Formula | C19H21F2N |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (3R,4S)-1-benzyl-3-(3,4-difluorophenyl)-4-ethylpyrrolidine |
| SMILES | CC[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21F2N/c1-2-15-12-22(11-14-6-4-3-5-7-14)13-17(15)16-8-9-18(20)19(21)10-16/h3-10,15,17H,2,11-13H2,1H3/t15-,17-/m1/s1 |
| InChIKey | BGWPLTAXYSEUIJ-NVXWUHKLSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |