C16H18F3N3 — CID 141137555
(3R,4R)-1-(1H-pyrrol-2-ylmethyl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine (PubChem CID 141137555) has the molecular formula C16H18F3N3 and a molecular weight of 309.33 g/mol. Its IUPAC name is (3R,4R)-1-(1H-pyrrol-2-ylmethyl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine.
| Compound Name | (3R,4R)-1-(1H-pyrrol-2-ylmethyl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 141137555 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3R,4R)-1-(1H-pyrrol-2-ylmethyl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine |
| SMILES | N[C@H]1CN(Cc2ccc[nH]2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H18F3N3/c17-13-7-15(19)14(18)6-12(13)11-3-5-22(9-16(11)20)8-10-2-1-4-21-10/h1-2,4,6-7,11,16,21H,3,5,8-9,20H2/t11-,16+/m1/s1 |
| InChIKey | BDOCQNBVHWPZCW-BZNIZROVSA-N |
| XLogP | 2.75 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|