C19H19Cl2N3S — CID 4991180
4-(3,4-dichlorophenyl)-2-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-1,3-thiazole (PubChem CID 4991180) has the molecular formula C19H19Cl2N3S and a molecular weight of 392.36 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-1,3-thiazole.
| Compound Name | 4-(3,4-dichlorophenyl)-2-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 4991180 |
| Molecular Formula | C19H19Cl2N3S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-1,3-thiazole |
| SMILES | Clc1ccc(-c2csc(C3CCN(Cc4ccc[nH]4)CC3)n2)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3S/c20-16-4-3-14(10-17(16)21)18-12-25-19(23-18)13-5-8-24(9-6-13)11-15-2-1-7-22-15/h1-4,7,10,12-13,22H,5-6,8-9,11H2 |
| InChIKey | JQEDBQXNONZLOM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'misc_pyrrole_thiaz(1)', 'substructure': 'N/A'} |
|---|