C21H22ClN3O3S — CID 3860856
4-(4-chloro-3-nitrophenyl)-2-[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-4-yl]-1,3-thiazole (PubChem CID 3860856) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is 4-(4-chloro-3-nitrophenyl)-2-[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-4-yl]-1,3-thiazole.
| Compound Name | 4-(4-chloro-3-nitrophenyl)-2-[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 3860856 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 4-(4-chloro-3-nitrophenyl)-2-[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-4-yl]-1,3-thiazole |
| SMILES | Cc1cc(CN2CCC(c3nc(-c4ccc(Cl)c([N+](=O)[O-])c4)cs3)CC2)oc1C |
| InChI | InChI=1S/C21H22ClN3O3S/c1-13-9-17(28-14(13)2)11-24-7-5-15(6-8-24)21-23-19(12-29-21)16-3-4-18(22)20(10-16)25(26)27/h3-4,9-10,12,15H,5-8,11H2,1-2H3 |
| InChIKey | BCLDRJRVFVHUEP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|