C23H19ClF3N3O4S — CID 3874398
1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-[2-(trifluoromethoxy)phenyl]ethanone (PubChem CID 3874398) has the molecular formula C23H19ClF3N3O4S and a molecular weight of 525.94 g/mol. Its IUPAC name is 1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-[2-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-[2-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 3874398 |
| Molecular Formula | C23H19ClF3N3O4S |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-[2-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1OC(F)(F)F)N1CCC(c2nc(-c3ccc(Cl)c([N+](=O)[O-])c3)cs2)CC1 |
| InChI | InChI=1S/C23H19ClF3N3O4S/c24-17-6-5-15(11-19(17)30(32)33)18-13-35-22(28-18)14-7-9-29(10-8-14)21(31)12-16-3-1-2-4-20(16)34-23(25,26)27/h1-6,11,13-14H,7-10,12H2 |
| InChIKey | NDHCZMCZAISBGB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|