C24H21F3N4O4S — CID 3724028
N-[2-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 3724028) has the molecular formula C24H21F3N4O4S and a molecular weight of 518.52 g/mol. Its IUPAC name is N-[2-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3724028 |
| Molecular Formula | C24H21F3N4O4S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[2-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCC(c2nc(-c3ccccc3[N+](=O)[O-])cs2)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H21F3N4O4S/c25-24(26,27)17-7-5-15(6-8-17)22(33)28-13-21(32)30-11-9-16(10-12-30)23-29-19(14-36-23)18-3-1-2-4-20(18)31(34)35/h1-8,14,16H,9-13H2,(H,28,33) |
| InChIKey | MWOSMMBLLOORDU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|