C23H20F3N5O4 — CID 43044619
N-[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 43044619) has the molecular formula C23H20F3N5O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is N-[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 43044619 |
| Molecular Formula | C23H20F3N5O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F3N5O4/c24-23(25,26)16-3-1-15(2-4-16)22(33)28-14-21(32)30-11-9-29(10-12-30)19-5-6-20(31(34)35)18-13-27-8-7-17(18)19/h1-8,13H,9-12,14H2,(H,28,33) |
| InChIKey | NINNFQCNTJBKSK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|