C16H19N5O3 — CID 41041453
(2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide (PubChem CID 41041453) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 41041453 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(N)=O)N1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1 |
| InChI | InChI=1S/C16H19N5O3/c1-11(16(17)22)19-6-8-20(9-7-19)14-2-3-15(21(23)24)13-10-18-5-4-12(13)14/h2-5,10-11H,6-9H2,1H3,(H2,17,22)/t11-/m0/s1 |
| InChIKey | KZTQYLGKLRMUGA-NSHDSACASA-N |
| XLogP | 1.14 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|