C23H22F3N5O3 — CID 42012372
(2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 42012372) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is (2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42012372 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (2S)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(C(F)(F)F)c1)N1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1 |
| InChI | InChI=1S/C23H22F3N5O3/c1-15(22(32)28-17-4-2-3-16(13-17)23(24,25)26)29-9-11-30(12-10-29)20-5-6-21(31(33)34)19-14-27-8-7-18(19)20/h2-8,13-15H,9-12H2,1H3,(H,28,32)/t15-/m0/s1 |
| InChIKey | LQVYTMKTIVJIJW-HNNXBMFYSA-N |
| XLogP | 4.31 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|