C22H22ClN5O3 — CID 42931520
N-(3-chlorophenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide (PubChem CID 42931520) has the molecular formula C22H22ClN5O3 and a molecular weight of 439.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide.
| Compound Name | N-(3-chlorophenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 42931520 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-(3-chlorophenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1cccc(Cl)c1)N1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1 |
| InChI | InChI=1S/C22H22ClN5O3/c1-15(22(29)25-17-4-2-3-16(23)13-17)26-9-11-27(12-10-26)20-5-6-21(28(30)31)19-14-24-8-7-18(19)20/h2-8,13-15H,9-12H2,1H3,(H,25,29) |
| InChIKey | UZBQZNSYCBNMGB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|