C15H18N4O4S — CID 36657808
5-(4-methylsulfonyl-1,4-diazepan-1-yl)-8-nitroisoquinoline (PubChem CID 36657808) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 5-(4-methylsulfonyl-1,4-diazepan-1-yl)-8-nitroisoquinoline.
| Compound Name | 5-(4-methylsulfonyl-1,4-diazepan-1-yl)-8-nitroisoquinoline |
|---|---|
| PubChem CID | 36657808 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5-(4-methylsulfonyl-1,4-diazepan-1-yl)-8-nitroisoquinoline |
| SMILES | CS(=O)(=O)N1CCCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1 |
| InChI | InChI=1S/C15H18N4O4S/c1-24(22,23)18-8-2-7-17(9-10-18)14-3-4-15(19(20)21)13-11-16-6-5-12(13)14/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | MXGFQDZFBQHABF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|