C22H22N6O5S — CID 43044636
N-[2-[[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 43044636) has the molecular formula C22H22N6O5S and a molecular weight of 482.52 g/mol. Its IUPAC name is N-[2-[[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 43044636 |
| Molecular Formula | C22H22N6O5S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[2-[[2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NCC(=O)N1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1 |
| InChI | InChI=1S/C22H22N6O5S/c29-20(13-25-22(31)19-2-1-11-34-19)24-14-21(30)27-9-7-26(8-10-27)17-3-4-18(28(32)33)16-12-23-6-5-15(16)17/h1-6,11-12H,7-10,13-14H2,(H,24,29)(H,25,31) |
| InChIKey | HODJKNVODPSXFP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|