C19H22N4O3S — CID 9037224
N-[2-oxo-2-[[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 9037224) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[2-oxo-2-[[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-oxo-2-[[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9037224 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[2-oxo-2-[[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N4O3S/c24-17(13-21-19(26)16-7-4-12-27-16)20-14-18(25)23-10-8-22(9-11-23)15-5-2-1-3-6-15/h1-7,12H,8-11,13-14H2,(H,20,24)(H,21,26) |
| InChIKey | FLSZPAQRWCAPLG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |