C17H24N4O3S — CID 18153023
N-[2-oxo-2-[4-(piperidine-1-carbonyl)piperazin-1-yl]ethyl]thiophene-2-carboxamide (PubChem CID 18153023) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(piperidine-1-carbonyl)piperazin-1-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-oxo-2-[4-(piperidine-1-carbonyl)piperazin-1-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18153023 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[2-oxo-2-[4-(piperidine-1-carbonyl)piperazin-1-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)N2CCCCC2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H24N4O3S/c22-15(13-18-16(23)14-5-4-12-25-14)19-8-10-21(11-9-19)17(24)20-6-2-1-3-7-20/h4-5,12H,1-3,6-11,13H2,(H,18,23) |
| InChIKey | HGQBGKDEKNNMSG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |