C10H12N2O5S — CID 66165843
2-hydroxy-3-[[2-(thiophene-2-carbonylamino)acetyl]amino]propanoic acid (PubChem CID 66165843) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-(thiophene-2-carbonylamino)acetyl]amino]propanoic acid.
| Compound Name | 2-hydroxy-3-[[2-(thiophene-2-carbonylamino)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66165843 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-hydroxy-3-[[2-(thiophene-2-carbonylamino)acetyl]amino]propanoic acid |
| SMILES | O=C(CNC(=O)c1cccs1)NCC(O)C(=O)O |
| InChI | InChI=1S/C10H12N2O5S/c13-6(10(16)17)4-11-8(14)5-12-9(15)7-2-1-3-18-7/h1-3,6,13H,4-5H2,(H,11,14)(H,12,15)(H,16,17) |
| InChIKey | QZGRFVMOLUYDQE-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |