C20H24N4O4 — CID 47048115
2-cyclopentyloxy-1-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]ethanone (PubChem CID 47048115) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-cyclopentyloxy-1-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-cyclopentyloxy-1-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 47048115 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-cyclopentyloxy-1-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(COC1CCCC1)N1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1 |
| InChI | InChI=1S/C20H24N4O4/c25-20(14-28-15-3-1-2-4-15)23-11-9-22(10-12-23)18-5-6-19(24(26)27)17-13-21-8-7-16(17)18/h5-8,13,15H,1-4,9-12,14H2 |
| InChIKey | GHFQGNCKQQHINI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|