C25H19ClN4O6S — CID 3771115
[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone (PubChem CID 3771115) has the molecular formula C25H19ClN4O6S and a molecular weight of 538.97 g/mol. Its IUPAC name is [4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone.
| Compound Name | [4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 3771115 |
| Molecular Formula | C25H19ClN4O6S |
| Molecular Weight | 538.97 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | [4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2[N+](=O)[O-])o1)N1CCC(c2nc(-c3ccc(Cl)c([N+](=O)[O-])c3)cs2)CC1 |
| InChI | InChI=1S/C25H19ClN4O6S/c26-18-6-5-16(13-21(18)30(34)35)19-14-37-24(27-19)15-9-11-28(12-10-15)25(31)23-8-7-22(36-23)17-3-1-2-4-20(17)29(32)33/h1-8,13-15H,9-12H2 |
| InChIKey | ZLKPHJDVONFFIE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 132.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.97 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|