C24H18ClF4N3O3S — CID 3846885
1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 3846885) has the molecular formula C24H18ClF4N3O3S and a molecular weight of 539.94 g/mol. Its IUPAC name is 1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3846885 |
| Molecular Formula | C24H18ClF4N3O3S |
| Molecular Weight | 539.94 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 1-[4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1F)N1CCC(c2nc(-c3ccc(Cl)c([N+](=O)[O-])c3)cs2)CC1 |
| InChI | InChI=1S/C24H18ClF4N3O3S/c25-18-6-4-16(12-20(18)32(34)35)19-13-36-23(30-19)15-8-10-31(11-9-15)21(33)7-5-14-2-1-3-17(22(14)26)24(27,28)29/h1-7,12-13,15H,8-11H2 |
| InChIKey | SHWZLTZSGBCFKI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.94 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|