C25H19N5O4S2 — CID 3677901
3-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]pyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 3677901) has the molecular formula C25H19N5O4S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 3-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]pyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 3-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]pyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 3677901 |
| Molecular Formula | C25H19N5O4S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 3-[4-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]pyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | O=C(c1cnc2sc3ccccc3n2c1=O)N1CCC(c2nc(-c3ccccc3[N+](=O)[O-])cs2)CC1 |
| InChI | InChI=1S/C25H19N5O4S2/c31-23(17-13-26-25-29(24(17)32)20-7-3-4-8-21(20)36-25)28-11-9-15(10-12-28)22-27-18(14-35-22)16-5-1-2-6-19(16)30(33)34/h1-8,13-15H,9-12H2 |
| InChIKey | RLDODWGREHCCKU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 110.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|