C21H17N5O5S2 — CID 3678647
2-[1-(1-benzofuran-2-carbonyl)piperidin-4-yl]-N-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 3678647) has the molecular formula C21H17N5O5S2 and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-[1-(1-benzofuran-2-carbonyl)piperidin-4-yl]-N-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(1-benzofuran-2-carbonyl)piperidin-4-yl]-N-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3678647 |
| Molecular Formula | C21H17N5O5S2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2-[1-(1-benzofuran-2-carbonyl)piperidin-4-yl]-N-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1csc(C2CCN(C(=O)c3cc4ccccc4o3)CC2)n1 |
| InChI | InChI=1S/C21H17N5O5S2/c27-18(24-21-22-10-17(33-21)26(29)30)14-11-32-19(23-14)12-5-7-25(8-6-12)20(28)16-9-13-3-1-2-4-15(13)31-16/h1-4,9-12H,5-8H2,(H,22,24,27) |
| InChIKey | KWCRBIUUCBVGRY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|