C18H17NO2S — CID 71786966
1-benzofuran-2-yl-(4-thiophen-3-ylpiperidin-1-yl)methanone (PubChem CID 71786966) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(4-thiophen-3-ylpiperidin-1-yl)methanone.
| Compound Name | 1-benzofuran-2-yl-(4-thiophen-3-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 71786966 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-benzofuran-2-yl-(4-thiophen-3-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCC(c2ccsc2)CC1 |
| InChI | InChI=1S/C18H17NO2S/c20-18(17-11-14-3-1-2-4-16(14)21-17)19-8-5-13(6-9-19)15-7-10-22-12-15/h1-4,7,10-13H,5-6,8-9H2 |
| InChIKey | HPPANBAZJVUCCB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |