C18H19N2O2S+ — CID 9180908
1-benzofuran-2-yl-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone (PubChem CID 9180908) has the molecular formula C18H19N2O2S+ and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | 1-benzofuran-2-yl-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 9180908 |
| Molecular Formula | C18H19N2O2S+ |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-benzofuran-2-yl-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H18N2O2S/c21-18(17-11-15-3-1-2-4-16(15)22-17)20-8-6-19(7-9-20)12-14-5-10-23-13-14/h1-5,10-11,13H,6-9,12H2/p+1 |
| InChIKey | HEWRPEPZFXGYAJ-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |